C21H28O3 — CID 143180558
3-ethenyl-6-methyl-3-(3-methylcyclohexyl)-6-[(E)-2-phenylethenyl]-1,2,4-trioxane (PubChem CID 143180558) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 3-ethenyl-6-methyl-3-(3-methylcyclohexyl)-6-[(E)-2-phenylethenyl]-1,2,4-trioxane.
| Compound Name | 3-ethenyl-6-methyl-3-(3-methylcyclohexyl)-6-[(E)-2-phenylethenyl]-1,2,4-trioxane |
|---|---|
| PubChem CID | 143180558 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 3-ethenyl-6-methyl-3-(3-methylcyclohexyl)-6-[(E)-2-phenylethenyl]-1,2,4-trioxane |
| SMILES | C=CC1(C2CCCC(C)C2)OCC(C)(/C=C/c2ccccc2)OO1 |
| InChI | InChI=1S/C21H28O3/c1-4-21(19-12-8-9-17(2)15-19)22-16-20(3,23-24-21)14-13-18-10-6-5-7-11-18/h4-7,10-11,13-14,17,19H,1,8-9,12,15-16H2,2-3H3/b14-13+ |
| InChIKey | ZUKLBZUHVXNKKA-BUHFOSPRSA-N |
| XLogP | 5.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|