About 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen
6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen (PubChem CID 143181218) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen.
Analyze 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
The IUPAC name of 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen (CID 143181218) is 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen.
What is the SMILES notation for 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
The canonical SMILES for 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen is CC1C=c2[nH]cnc2=CC1.[H][H].
What is the InChIKey of 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
The InChIKey is ODDLSIAYXLWOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.H2/c1-6-2-3-7-8(4-6)10-5-9-7;/h3-6H,2H2,1H3,(H,9,10);1H.
What are the key properties of 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen has a molecular weight of 136.20 g/mol, XLogP of 0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen is sourced from PubChem (CID 143181218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).