C17H30N2O2 — CID 143181225
(2E,4E)-5-(3-morpholin-4-ylpropoxy)-N-propan-2-ylhepta-2,4,6-trien-2-amine (PubChem CID 143181225) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2E,4E)-5-(3-morpholin-4-ylpropoxy)-N-propan-2-ylhepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-5-(3-morpholin-4-ylpropoxy)-N-propan-2-ylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 143181225 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | (2E,4E)-5-(3-morpholin-4-ylpropoxy)-N-propan-2-ylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)NC(C)C)OCCCN1CCOCC1 |
| InChI | InChI=1S/C17H30N2O2/c1-5-17(8-7-16(4)18-15(2)3)21-12-6-9-19-10-13-20-14-11-19/h5,7-8,15,18H,1,6,9-14H2,2-4H3/b16-7+,17-8+ |
| InChIKey | VXBYVVQQBADTIO-GDWCLCACSA-N |
| XLogP | 2.70 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|