About 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal
3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal (PubChem CID 143181550) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal.
Molecular Properties
| Compound Name | 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal |
| PubChem CID | 143181550 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal |
| SMILES | CCN(CCC(C)(F)F)CC(C)(C)C=O |
| InChI | InChI=1S/C11H21F2NO/c1-5-14(7-6-11(4,12)13)8-10(2,3)9-15/h9H,5-8H2,1-4H3 |
| InChIKey | VXMCWOZRMTYXHF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal?
The IUPAC name of 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal (CID 143181550) is 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal.
What is the SMILES notation for 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal?
The canonical SMILES for 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal is CCN(CCC(C)(F)F)CC(C)(C)C=O.
What is the InChIKey of 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal?
The InChIKey is VXMCWOZRMTYXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO/c1-5-14(7-6-11(4,12)13)8-10(2,3)9-15/h9H,5-8H2,1-4H3.
What are the key properties of 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal?
3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal has a molecular weight of 221.29 g/mol, XLogP of 2.58, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-difluorobutyl(ethyl)amino]-2,2-dimethylpropanal is sourced from PubChem (CID 143181550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).