About 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine
1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine (PubChem CID 143181551) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine.
Molecular Properties
| Compound Name | 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine |
| PubChem CID | 143181551 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine |
| SMILES | CC1C=C(N2CCN(C)CC2)N=CC1 |
| InChI | InChI=1S/C11H19N3/c1-10-3-4-12-11(9-10)14-7-5-13(2)6-8-14/h4,9-10H,3,5-8H2,1-2H3 |
| InChIKey | VPLUMVZYLFRNBC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine?
The IUPAC name of 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine (CID 143181551) is 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine.
What is the SMILES notation for 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine?
The canonical SMILES for 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine is CC1C=C(N2CCN(C)CC2)N=CC1.
What is the InChIKey of 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine?
The InChIKey is VPLUMVZYLFRNBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-10-3-4-12-11(9-10)14-7-5-13(2)6-8-14/h4,9-10H,3,5-8H2,1-2H3.
What are the key properties of 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine?
1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine has a molecular weight of 193.29 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(4-methyl-3,4-dihydropyridin-6-yl)piperazine is sourced from PubChem (CID 143181551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).