About methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid
methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid (PubChem CID 143181593) has the molecular formula C14H20F3NO2
and a molecular weight of 291.31 g/mol. Its IUPAC name is methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid.
Molecular Properties
| Compound Name | methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid |
| PubChem CID | 143181593 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid |
| SMILES | C.CCC.O=C(O)C/N=C(\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO2.C3H8.CH4/c11-10(12,13)9(14-6-8(15)16)7-4-2-1-3-5-7;1-3-2;/h1-5H,6H2,(H,15,16);3H2,1-2H3;1H4/b14-9+;; |
| InChIKey | WAKAHYIYKPAPKA-CAJRCRMVSA-N |
| XLogP | 4.18 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid?
The IUPAC name of methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid (CID 143181593) is methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid.
What is the SMILES notation for methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid?
The canonical SMILES for methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid is C.CCC.O=C(O)C/N=C(\c1ccccc1)C(F)(F)F.
What is the InChIKey of methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid?
The InChIKey is WAKAHYIYKPAPKA-CAJRCRMVSA-N. The full InChI is InChI=1S/C10H8F3NO2.C3H8.CH4/c11-10(12,13)9(14-6-8(15)16)7-4-2-1-3-5-7;1-3-2;/h1-5H,6H2,(H,15,16);3H2,1-2H3;1H4/b14-9+;;.
What are the key properties of methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid?
methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid has a molecular weight of 291.31 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;propane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid is sourced from PubChem (CID 143181593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).