C15H20F3NO2 — CID 143181610
2,2-dimethylpropane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid (PubChem CID 143181610) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2,2-dimethylpropane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid.
| Compound Name | 2,2-dimethylpropane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid |
|---|---|
| PubChem CID | 143181610 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2,2-dimethylpropane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetic acid |
| SMILES | CC(C)(C)C.O=C(O)C/N=C(\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO2.C5H12/c11-10(12,13)9(14-6-8(15)16)7-4-2-1-3-5-7;1-5(2,3)4/h1-5H,6H2,(H,15,16);1-4H3/b14-9+; |
| InChIKey | YKHSBWLELVCGHT-KYIGKLDSSA-N |
| XLogP | 4.18 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|