About (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one
(2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one (PubChem CID 1431818) has the molecular formula C23H23N3O3
and a molecular weight of 389.46 g/mol. Its IUPAC name is (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one |
| PubChem CID | 1431818 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one |
| SMILES | CC[C@@H]1Oc2ccc(C(=O)n3nc(C)cc3C)cc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H23N3O3/c1-4-20-23(28)25(14-17-8-6-5-7-9-17)19-13-18(10-11-21(19)29-20)22(27)26-16(3)12-15(2)24-26/h5-13,20H,4,14H2,1-3H3/t20-/m0/s1 |
| InChIKey | LYGJVLBIVWZLPY-FQEVSTJZSA-N |
| XLogP | 3.89 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one?
The IUPAC name of (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one (CID 1431818) is (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one.
What is the SMILES notation for (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one?
The canonical SMILES for (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one is CC[C@@H]1Oc2ccc(C(=O)n3nc(C)cc3C)cc2N(Cc2ccccc2)C1=O.
What is the InChIKey of (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one?
The InChIKey is LYGJVLBIVWZLPY-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H23N3O3/c1-4-20-23(28)25(14-17-8-6-5-7-9-17)19-13-18(10-11-21(19)29-20)22(27)26-16(3)12-15(2)24-26/h5-13,20H,4,14H2,1-3H3/t20-/m0/s1.
What are the key properties of (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one?
(2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one has a molecular weight of 389.46 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-benzyl-6-(3,5-dimethylpyrazole-1-carbonyl)-2-ethyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 1431818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).