C31H52O3 — CID 143181824
(1R,4R,5R,8S,12R,15R)-5-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-15-[(3S)-3-hydroxy-4-methylpentyl]-4,8-dimethyltetracyclo[10.2.1.01,9.04,8]pentadec-10-en-14-ol (PubChem CID 143181824) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (1R,4R,5R,8S,12R,15R)-5-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-15-[(3S)-3-hydroxy-4-methylpentyl]-4,8-dimethyltetracyclo[10.2.1.01,9.04,8]pentadec-10-en-14-ol.
| Compound Name | (1R,4R,5R,8S,12R,15R)-5-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-15-[(3S)-3-hydroxy-4-methylpentyl]-4,8-dimethyltetracyclo[10.2.1.01,9.04,8]pentadec-10-en-14-ol |
|---|---|
| PubChem CID | 143181824 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (1R,4R,5R,8S,12R,15R)-5-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-15-[(3S)-3-hydroxy-4-methylpentyl]-4,8-dimethyltetracyclo[10.2.1.01,9.04,8]pentadec-10-en-14-ol |
| SMILES | CC(C)[C@@H](O)CC[C@@H]1[C@H]2C=CC3[C@]1(CC[C@]1(C)[C@@H]([C@H](C)C/C=C/C(C)(C)O)CC[C@@]31C)C(O)C2 |
| InChI | InChI=1S/C31H52O3/c1-20(2)25(32)12-11-24-22-10-13-26-30(7)16-14-23(21(3)9-8-15-28(4,5)34)29(30,6)17-18-31(24,26)27(33)19-22/h8,10,13,15,20-27,32-34H,9,11-12,14,16-19H2,1-7H3/b15-8+/t21-,22+,23-,24-,25+,26?,27?,29-,30+,31-/m1/s1 |
| InChIKey | TYYXHHQVTIRNOX-LUMSHUEWSA-N |
| XLogP | 6.52 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|