C13H16N2O2 — CID 143181839
4-(2-methylpyrazol-3-yl)-6-propylbenzene-1,3-diol (PubChem CID 143181839) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-(2-methylpyrazol-3-yl)-6-propylbenzene-1,3-diol.
| Compound Name | 4-(2-methylpyrazol-3-yl)-6-propylbenzene-1,3-diol |
|---|---|
| PubChem CID | 143181839 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-(2-methylpyrazol-3-yl)-6-propylbenzene-1,3-diol |
| SMILES | CCCc1cc(-c2ccnn2C)c(O)cc1O |
| InChI | InChI=1S/C13H16N2O2/c1-3-4-9-7-10(13(17)8-12(9)16)11-5-6-14-15(11)2/h5-8,16-17H,3-4H2,1-2H3 |
| InChIKey | WXHNABPGNFXQJG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |