C28H34N4O2S — CID 143182244
N-[4-[[methyl(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)amino]methoxy]phenyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide (PubChem CID 143182244) has the molecular formula C28H34N4O2S and a molecular weight of 490.67 g/mol. Its IUPAC name is N-[4-[[methyl(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)amino]methoxy]phenyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-[4-[[methyl(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)amino]methoxy]phenyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 143182244 |
| Molecular Formula | C28H34N4O2S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[4-[[methyl(1,2,3,4,6,7,8,9-octahydroquinolizin-9a-yl)amino]methoxy]phenyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
| SMILES | Cc1nc(-c2ccc(C(=O)Nc3ccc(OCN(C)C45CCCCN4CCCC5)cc3)cc2)cs1 |
| InChI | InChI=1S/C28H34N4O2S/c1-21-29-26(19-35-21)22-7-9-23(10-8-22)27(33)30-24-11-13-25(14-12-24)34-20-31(2)28-15-3-5-17-32(28)18-6-4-16-28/h7-14,19H,3-6,15-18,20H2,1-2H3,(H,30,33) |
| InChIKey | MXLUZQCDLISDRH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|