C26H46N2O2 — CID 143182423
4-[4-[(E)-2,3-dimethoxyprop-1-enyl]-5-ethenyl-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine;ethene;(2Z,4Z)-3-methylhexa-2,4-diene (PubChem CID 143182423) has the molecular formula C26H46N2O2 and a molecular weight of 418.67 g/mol. Its IUPAC name is 4-[4-[(E)-2,3-dimethoxyprop-1-enyl]-5-ethenyl-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine;ethene;(2Z,4Z)-3-methylhexa-2,4-diene.
| Compound Name | 4-[4-[(E)-2,3-dimethoxyprop-1-enyl]-5-ethenyl-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine;ethene;(2Z,4Z)-3-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 143182423 |
| Molecular Formula | C26H46N2O2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | 4-[4-[(E)-2,3-dimethoxyprop-1-enyl]-5-ethenyl-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine;ethene;(2Z,4Z)-3-methylhexa-2,4-diene |
| SMILES | C/C=C\C(C)=C/C.C=C.C=CC1=C(/C=C(\COC)OC)CCN(CCCCNC)C1 |
| InChI | InChI=1S/C17H30N2O2.C7H12.C2H4/c1-5-15-13-19(10-7-6-9-18-2)11-8-16(15)12-17(21-4)14-20-3;1-4-6-7(3)5-2;1-2/h5,12,18H,1,6-11,13-14H2,2-4H3;4-6H,1-3H3;1-2H2/b17-12+;6-4-,7-5-; |
| InChIKey | XIMNUARZDSXUTN-FCYKDHFLSA-N |
| XLogP | 5.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|