C17H20N2O5S — CID 143182928
(2,5-dioxocycloheptyl) 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 143182928) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2,5-dioxocycloheptyl) 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | (2,5-dioxocycloheptyl) 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 143182928 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2,5-dioxocycloheptyl) 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | O=C1CCC(=O)C(OC(=O)CCCCc2scc3[nH]c(=O)[nH]c23)CC1 |
| InChI | InChI=1S/C17H20N2O5S/c20-10-5-7-12(21)13(8-6-10)24-15(22)4-2-1-3-14-16-11(9-25-14)18-17(23)19-16/h9,13H,1-8H2,(H2,18,19,23) |
| InChIKey | JNWRBDZSLLJKRQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|