About acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione
acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione (PubChem CID 143183236) has the molecular formula C21H31NO4
and a molecular weight of 361.48 g/mol. Its IUPAC name is acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione.
Molecular Properties
| Compound Name | acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione |
| PubChem CID | 143183236 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione |
| SMILES | C#C.CC/N=C/C(OC)=C(\C)CCC1(C2CCCC2)CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C19H29NO4.C2H2/c1-4-20-13-17(23-3)14(2)9-10-19(15-7-5-6-8-15)12-16(21)11-18(22)24-19;1-2/h13,15H,4-12H2,1-3H3;1-2H/b17-14-,20-13+; |
| InChIKey | GPJDJPZOOAIPKT-PIBNOSPRSA-N |
| XLogP | 3.86 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione?
The IUPAC name of acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione (CID 143183236) is acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione.
What is the SMILES notation for acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione?
The canonical SMILES for acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione is C#C.CC/N=C/C(OC)=C(\C)CCC1(C2CCCC2)CC(=O)CC(=O)O1.
What is the InChIKey of acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione?
The InChIKey is GPJDJPZOOAIPKT-PIBNOSPRSA-N. The full InChI is InChI=1S/C19H29NO4.C2H2/c1-4-20-13-17(23-3)14(2)9-10-19(15-7-5-6-8-15)12-16(21)11-18(22)24-19;1-2/h13,15H,4-12H2,1-3H3;1-2H/b17-14-,20-13+;.
What are the key properties of acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione?
acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione has a molecular weight of 361.48 g/mol, XLogP of 3.86, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;6-cyclopentyl-6-[(Z)-5-ethylimino-4-methoxy-3-methylpent-3-enyl]oxane-2,4-dione is sourced from PubChem (CID 143183236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).