C20H13F2N3OS — CID 143183463
3-[6-(2,4-difluorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-methylbenzaldehyde (PubChem CID 143183463) has the molecular formula C20H13F2N3OS and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-[6-(2,4-difluorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-methylbenzaldehyde.
| Compound Name | 3-[6-(2,4-difluorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-methylbenzaldehyde |
|---|---|
| PubChem CID | 143183463 |
| Molecular Formula | C20H13F2N3OS |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 3-[6-(2,4-difluorophenyl)sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-methylbenzaldehyde |
| SMILES | Cc1ccc(C=O)cc1-c1nnc2ccc(Sc3ccc(F)cc3F)cn12 |
| InChI | InChI=1S/C20H13F2N3OS/c1-12-2-3-13(11-26)8-16(12)20-24-23-19-7-5-15(10-25(19)20)27-18-6-4-14(21)9-17(18)22/h2-11H,1H3 |
| InChIKey | HZCXUZXDZGUONF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|