C17H20N2 — CID 143183552
N-[(1E,3E)-5-cyclohexa-1,5-dien-1-yliminopenta-1,3-dienyl]cyclohexa-1,5-dien-1-amine (PubChem CID 143183552) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[(1E,3E)-5-cyclohexa-1,5-dien-1-yliminopenta-1,3-dienyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-[(1E,3E)-5-cyclohexa-1,5-dien-1-yliminopenta-1,3-dienyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 143183552 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[(1E,3E)-5-cyclohexa-1,5-dien-1-yliminopenta-1,3-dienyl]cyclohexa-1,5-dien-1-amine |
| SMILES | C1=CC(/N=C/C=C/C=C/NC2=CCCC=C2)=CCC1 |
| InChI | InChI=1S/C17H20N2/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17/h3-4,6,8-15,18H,1-2,5,7H2/b9-3+,14-8+,19-15+ |
| InChIKey | HJKNJKYWRNJJGT-GLBDIXCZSA-N |
| XLogP | 4.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|