About 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane
2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane (PubChem CID 143183936) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane.
Molecular Properties
| Compound Name | 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane |
| PubChem CID | 143183936 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane |
| SMILES | COC1=C(CC2CO2)CCC=C1 |
| InChI | InChI=1S/C10H14O2/c1-11-10-5-3-2-4-8(10)6-9-7-12-9/h3,5,9H,2,4,6-7H2,1H3 |
| InChIKey | NUKIALYZCQFIDW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane?
The IUPAC name of 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane (CID 143183936) is 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane.
What is the SMILES notation for 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane?
The canonical SMILES for 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane is COC1=C(CC2CO2)CCC=C1.
What is the InChIKey of 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane?
The InChIKey is NUKIALYZCQFIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-11-10-5-3-2-4-8(10)6-9-7-12-9/h3,5,9H,2,4,6-7H2,1H3.
What are the key properties of 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane?
2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane has a molecular weight of 166.22 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methoxycyclohexa-1,3-dien-1-yl)methyl]oxirane is sourced from PubChem (CID 143183936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).