About 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile
6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile (PubChem CID 143184572) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile |
| PubChem CID | 143184572 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile |
| SMILES | CCn1cc(C#N)c2ccc(N3C=CCC3)cc21 |
| InChI | InChI=1S/C15H15N3/c1-2-17-11-12(10-16)14-6-5-13(9-15(14)17)18-7-3-4-8-18/h3,5-7,9,11H,2,4,8H2,1H3 |
| InChIKey | SSKSNEKGTASBSB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile?
The IUPAC name of 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile (CID 143184572) is 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile.
What is the SMILES notation for 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile?
The canonical SMILES for 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile is CCn1cc(C#N)c2ccc(N3C=CCC3)cc21.
What is the InChIKey of 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile?
The InChIKey is SSKSNEKGTASBSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3/c1-2-17-11-12(10-16)14-6-5-13(9-15(14)17)18-7-3-4-8-18/h3,5-7,9,11H,2,4,8H2,1H3.
What are the key properties of 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile?
6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile has a molecular weight of 237.31 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydropyrrol-1-yl)-1-ethylindole-3-carbonitrile is sourced from PubChem (CID 143184572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).