C16H16N4OS2 — CID 143185659
2-[5-(2,3-dihydrothiophen-5-yl)-1,2,4-oxadiazol-3-yl]-4,5,6-trimethylthieno[2,3-b]pyridin-3-amine (PubChem CID 143185659) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is 2-[5-(2,3-dihydrothiophen-5-yl)-1,2,4-oxadiazol-3-yl]-4,5,6-trimethylthieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-[5-(2,3-dihydrothiophen-5-yl)-1,2,4-oxadiazol-3-yl]-4,5,6-trimethylthieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 143185659 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[5-(2,3-dihydrothiophen-5-yl)-1,2,4-oxadiazol-3-yl]-4,5,6-trimethylthieno[2,3-b]pyridin-3-amine |
| SMILES | Cc1nc2sc(-c3noc(C4=CCCS4)n3)c(N)c2c(C)c1C |
| InChI | InChI=1S/C16H16N4OS2/c1-7-8(2)11-12(17)13(23-16(11)18-9(7)3)14-19-15(21-20-14)10-5-4-6-22-10/h5H,4,6,17H2,1-3H3 |
| InChIKey | MZSZQORABUDISZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |