C22H33IN4O4S — CID 143185811
2-iodopropan-2-yl 3-amino-5-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 143185811) has the molecular formula C22H33IN4O4S and a molecular weight of 576.50 g/mol. Its IUPAC name is 2-iodopropan-2-yl 3-amino-5-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | 2-iodopropan-2-yl 3-amino-5-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143185811 |
| Molecular Formula | C22H33IN4O4S |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 2-iodopropan-2-yl 3-amino-5-[2-[4-(2-methoxyethyl)piperazin-1-yl]ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | COCCN1CCN(CCOc2c(C)nc3sc(C(=O)OC(C)(C)I)c(N)c3c2C)CC1 |
| InChI | InChI=1S/C22H33IN4O4S/c1-14-16-17(24)19(21(28)31-22(3,4)23)32-20(16)25-15(2)18(14)30-13-11-27-8-6-26(7-9-27)10-12-29-5/h6-13,24H2,1-5H3 |
| InChIKey | SUSRCMZAHAFQEF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|