C20H29Cl2N5O — CID 143186197
1-[(2R)-2-bicyclo[3.1.0]hexanyl]-3-(2,6-dichloro-4-pyridinyl)-1-[3-[(2S)-2-methylpiperazin-1-yl]propyl]urea (PubChem CID 143186197) has the molecular formula C20H29Cl2N5O and a molecular weight of 426.39 g/mol. Its IUPAC name is 1-[(2R)-2-bicyclo[3.1.0]hexanyl]-3-(2,6-dichloro-4-pyridinyl)-1-[3-[(2S)-2-methylpiperazin-1-yl]propyl]urea.
| Compound Name | 1-[(2R)-2-bicyclo[3.1.0]hexanyl]-3-(2,6-dichloro-4-pyridinyl)-1-[3-[(2S)-2-methylpiperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 143186197 |
| Molecular Formula | C20H29Cl2N5O |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-[(2R)-2-bicyclo[3.1.0]hexanyl]-3-(2,6-dichloro-4-pyridinyl)-1-[3-[(2S)-2-methylpiperazin-1-yl]propyl]urea |
| SMILES | C[C@H]1CNCCN1CCCN(C(=O)Nc1cc(Cl)nc(Cl)c1)[C@@H]1CCC2CC21 |
| InChI | InChI=1S/C20H29Cl2N5O/c1-13-12-23-5-8-26(13)6-2-7-27(17-4-3-14-9-16(14)17)20(28)24-15-10-18(21)25-19(22)11-15/h10-11,13-14,16-17,23H,2-9,12H2,1H3,(H,24,25,28)/t13-,14?,16?,17+/m0/s1 |
| InChIKey | RILRCHJPWPSIMA-VFNXUKNFSA-N |
| XLogP | 3.70 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|