C17H22F3NO2 — CID 143186252
ethane;2,2,2-trifluoro-1-(7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl)ethanone (PubChem CID 143186252) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-1-(7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl)ethanone.
| Compound Name | ethane;2,2,2-trifluoro-1-(7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl)ethanone |
|---|---|
| PubChem CID | 143186252 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethane;2,2,2-trifluoro-1-(7-hydroxy-2,4,7,8,9,10-hexahydro-1H-benzo[f]isoquinolin-3-yl)ethanone |
| SMILES | CC.O=C(N1CCc2c(ccc3c2CCCC3O)C1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO2.C2H6/c16-15(17,18)14(21)19-7-6-10-9(8-19)4-5-12-11(10)2-1-3-13(12)20;1-2/h4-5,13,20H,1-3,6-8H2;1-2H3 |
| InChIKey | ZFDKPJAEBYXUHC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |