C41H45N3O6 — CID 143186733
methyl (E)-3-[4-[[1-[[(5S,6R)-13-cycloheptyl-5,6-dihydroxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate (PubChem CID 143186733) has the molecular formula C41H45N3O6 and a molecular weight of 675.83 g/mol. Its IUPAC name is methyl (E)-3-[4-[[1-[[(5S,6R)-13-cycloheptyl-5,6-dihydroxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[1-[[(5S,6R)-13-cycloheptyl-5,6-dihydroxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 143186733 |
| Molecular Formula | C41H45N3O6 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | methyl (E)-3-[4-[[1-[[(5S,6R)-13-cycloheptyl-5,6-dihydroxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCCCC5)c5n(c4c3)C[C@@H](O)[C@@H](O)c3ccccc3-5)CCCC2)cc1 |
| InChI | InChI=1S/C41H45N3O6/c1-50-35(46)21-16-26-14-18-29(19-15-26)42-40(49)41(22-8-9-23-41)43-39(48)28-17-20-32-33(24-28)44-25-34(45)38(47)31-13-7-6-12-30(31)37(44)36(32)27-10-4-2-3-5-11-27/h6-7,12-21,24,27,34,38,45,47H,2-5,8-11,22-23,25H2,1H3,(H,42,49)(H,43,48)/b21-16+/t34-,38+/m1/s1 |
| InChIKey | BNDYBOPWLRYIDL-QLIGXGHASA-N |
| XLogP | 7.02 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|