About 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one
4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one (PubChem CID 143186983) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one.
Molecular Properties
| Compound Name | 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one |
| PubChem CID | 143186983 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one |
| SMILES | CC1(N)C=CN=C2C(=O)CCCC2=C1 |
| InChI | InChI=1S/C11H14N2O/c1-11(12)5-6-13-10-8(7-11)3-2-4-9(10)14/h5-7H,2-4,12H2,1H3 |
| InChIKey | PFWKYGOHNBALBW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
The IUPAC name of 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one (CID 143186983) is 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one.
What is the SMILES notation for 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
The canonical SMILES for 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one is CC1(N)C=CN=C2C(=O)CCCC2=C1.
What is the InChIKey of 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
The InChIKey is PFWKYGOHNBALBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-11(12)5-6-13-10-8(7-11)3-2-4-9(10)14/h5-7H,2-4,12H2,1H3.
What are the key properties of 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one has a molecular weight of 190.25 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one is sourced from PubChem (CID 143186983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).