C23H35BrO4S2 — CID 143187122
(E)-1-(4-bromo-5-methylthiophen-2-yl)sulfanyl-4-[(1R,2R)-3-hydroxy-2-prop-2-enylcyclopentyl]but-3-en-2-one;butanoic acid;ethane (PubChem CID 143187122) has the molecular formula C23H35BrO4S2 and a molecular weight of 519.57 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-methylthiophen-2-yl)sulfanyl-4-[(1R,2R)-3-hydroxy-2-prop-2-enylcyclopentyl]but-3-en-2-one;butanoic acid;ethane.
| Compound Name | (E)-1-(4-bromo-5-methylthiophen-2-yl)sulfanyl-4-[(1R,2R)-3-hydroxy-2-prop-2-enylcyclopentyl]but-3-en-2-one;butanoic acid;ethane |
|---|---|
| PubChem CID | 143187122 |
| Molecular Formula | C23H35BrO4S2 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (E)-1-(4-bromo-5-methylthiophen-2-yl)sulfanyl-4-[(1R,2R)-3-hydroxy-2-prop-2-enylcyclopentyl]but-3-en-2-one;butanoic acid;ethane |
| SMILES | C=CC[C@H]1C(O)CC[C@@H]1/C=C/C(=O)CSc1cc(Br)c(C)s1.CC.CCCC(=O)O |
| InChI | InChI=1S/C17H21BrO2S2.C4H8O2.C2H6/c1-3-4-14-12(6-8-16(14)20)5-7-13(19)10-21-17-9-15(18)11(2)22-17;1-2-3-4(5)6;1-2/h3,5,7,9,12,14,16,20H,1,4,6,8,10H2,2H3;2-3H2,1H3,(H,5,6);1-2H3/b7-5+;;/t12-,14+,16?;;/m0../s1 |
| InChIKey | OKRVTEBPNYAHAI-SOKYUCITSA-N |
| XLogP | 6.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|