C22H22N4O3S2 — CID 143187497
N-[3-(2-hydroxyethylamino)propyl]-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide (PubChem CID 143187497) has the molecular formula C22H22N4O3S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is N-[3-(2-hydroxyethylamino)propyl]-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[3-(2-hydroxyethylamino)propyl]-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143187497 |
| Molecular Formula | C22H22N4O3S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[3-(2-hydroxyethylamino)propyl]-N-[4-(3-phenyl-1,2-oxazol-5-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(c1cccs1)N(CCCNCCO)c1nc(-c2cc(-c3ccccc3)no2)cs1 |
| InChI | InChI=1S/C22H22N4O3S2/c27-12-10-23-9-5-11-26(21(28)20-8-4-13-30-20)22-24-18(15-31-22)19-14-17(25-29-19)16-6-2-1-3-7-16/h1-4,6-8,13-15,23,27H,5,9-12H2 |
| InChIKey | HGAWHNOUNDPNKM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|