C28H27F3N2O3 — CID 143187755
5-[4-(pyridin-2-ylmethyl)cyclohexa-1,5-dien-1-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4-tetrahydroisoindole-1,7-diol (PubChem CID 143187755) has the molecular formula C28H27F3N2O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is 5-[4-(pyridin-2-ylmethyl)cyclohexa-1,5-dien-1-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4-tetrahydroisoindole-1,7-diol.
| Compound Name | 5-[4-(pyridin-2-ylmethyl)cyclohexa-1,5-dien-1-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4-tetrahydroisoindole-1,7-diol |
|---|---|
| PubChem CID | 143187755 |
| Molecular Formula | C28H27F3N2O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 5-[4-(pyridin-2-ylmethyl)cyclohexa-1,5-dien-1-yl]-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4-tetrahydroisoindole-1,7-diol |
| SMILES | OC1=C2C(CC(C3=CCC(Cc4ccccn4)C=C3)=C1)CN(Cc1ccc(OC(F)(F)F)cc1)C2O |
| InChI | InChI=1S/C28H27F3N2O3/c29-28(30,31)36-24-10-6-19(7-11-24)16-33-17-22-14-21(15-25(34)26(22)27(33)35)20-8-4-18(5-9-20)13-23-3-1-2-12-32-23/h1-4,6-12,15,18,22,27,34-35H,5,13-14,16-17H2 |
| InChIKey | ZDSVPORBUHEKKI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |