C31H28ClNO6 — CID 143188245
3-[(3'E,4'E)-5-chloro-6-hydroxy-5'-oxo-3',4'-bis(prop-2-enylidene)spiro[3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene-10,2'-oxolane]-7-yl]propanoic acid (PubChem CID 143188245) has the molecular formula C31H28ClNO6 and a molecular weight of 546.02 g/mol. Its IUPAC name is 3-[(3'E,4'E)-5-chloro-6-hydroxy-5'-oxo-3',4'-bis(prop-2-enylidene)spiro[3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene-10,2'-oxolane]-7-yl]propanoic acid.
| Compound Name | 3-[(3'E,4'E)-5-chloro-6-hydroxy-5'-oxo-3',4'-bis(prop-2-enylidene)spiro[3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene-10,2'-oxolane]-7-yl]propanoic acid |
|---|---|
| PubChem CID | 143188245 |
| Molecular Formula | C31H28ClNO6 |
| Molecular Weight | 546.02 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 3-[(3'E,4'E)-5-chloro-6-hydroxy-5'-oxo-3',4'-bis(prop-2-enylidene)spiro[3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaene-10,2'-oxolane]-7-yl]propanoic acid |
| SMILES | C=C/C=C1/C(=O)OC2(/C1=C/C=C)c1cc(CCC(=O)O)c(O)c(Cl)c1Oc1c2cc2c3c1CCCN3CCC2 |
| InChI | InChI=1S/C31H28ClNO6/c1-3-7-19-21(8-4-2)31(39-30(19)37)22-15-17-9-5-13-33-14-6-10-20(26(17)33)28(22)38-29-23(31)16-18(11-12-24(34)35)27(36)25(29)32/h3-4,7-8,15-16,36H,1-2,5-6,9-14H2,(H,34,35)/b19-7+,21-8+ |
| InChIKey | XTPSKZLJXXFLPG-KBUNWPLASA-N |
| XLogP | 5.89 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.02 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|