C7H13NO — CID 143188807
2,3-dimethyl-4,5,6,7-tetrahydro-1,4-oxazepine (PubChem CID 143188807) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is 2,3-dimethyl-4,5,6,7-tetrahydro-1,4-oxazepine.
| Compound Name | 2,3-dimethyl-4,5,6,7-tetrahydro-1,4-oxazepine |
|---|---|
| PubChem CID | 143188807 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 2,3-dimethyl-4,5,6,7-tetrahydro-1,4-oxazepine |
| SMILES | CC1=C(C)OCCCN1 |
| InChI | InChI=1S/C7H13NO/c1-6-7(2)9-5-3-4-8-6/h8H,3-5H2,1-2H3 |
| InChIKey | ZBWFKZVAZRKVMM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |