About 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine
4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine (PubChem CID 143189212) has the molecular formula C20H35NO
and a molecular weight of 305.51 g/mol. Its IUPAC name is 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine.
Molecular Properties
| Compound Name | 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine |
| PubChem CID | 143189212 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine |
| SMILES | C/C=C1\CCC(C)C(C2C[C@@H](C)CC[C@@H]2N2CCOCC2)C1 |
| InChI | InChI=1S/C20H35NO/c1-4-17-7-6-16(3)18(14-17)19-13-15(2)5-8-20(19)21-9-11-22-12-10-21/h4,15-16,18-20H,5-14H2,1-3H3/b17-4+/t15-,16?,18?,19?,20-/m0/s1 |
| InChIKey | UFQMRWQRDIQQAI-IJEBCSFPSA-N |
| XLogP | 4.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine?
The IUPAC name of 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine (CID 143189212) is 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine.
What is the SMILES notation for 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine?
The canonical SMILES for 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine is C/C=C1\CCC(C)C(C2C[C@@H](C)CC[C@@H]2N2CCOCC2)C1.
What is the InChIKey of 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine?
The InChIKey is UFQMRWQRDIQQAI-IJEBCSFPSA-N. The full InChI is InChI=1S/C20H35NO/c1-4-17-7-6-16(3)18(14-17)19-13-15(2)5-8-20(19)21-9-11-22-12-10-21/h4,15-16,18-20H,5-14H2,1-3H3/b17-4+/t15-,16?,18?,19?,20-/m0/s1.
What are the key properties of 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine?
4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine has a molecular weight of 305.51 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,4S)-2-[(5E)-5-ethylidene-2-methylcyclohexyl]-4-methylcyclohexyl]morpholine is sourced from PubChem (CID 143189212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).