C9H17N — CID 14318945
N,N,4-trimethylcyclohexen-1-amine (PubChem CID 14318945) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is N,N,4-trimethylcyclohexen-1-amine.
| Compound Name | N,N,4-trimethylcyclohexen-1-amine |
|---|---|
| PubChem CID | 14318945 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N,N,4-trimethylcyclohexen-1-amine |
| SMILES | CC1CC=C(N(C)C)CC1 |
| InChI | InChI=1S/C9H17N/c1-8-4-6-9(7-5-8)10(2)3/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | TYZVXSRSQDSPHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |