C22H32O3 — CID 143189896
[(8S,12R,15S)-8,12-dimethyl-6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadec-17-en-15-yl] acetate (PubChem CID 143189896) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(8S,12R,15S)-8,12-dimethyl-6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadec-17-en-15-yl] acetate.
| Compound Name | [(8S,12R,15S)-8,12-dimethyl-6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadec-17-en-15-yl] acetate |
|---|---|
| PubChem CID | 143189896 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(8S,12R,15S)-8,12-dimethyl-6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadec-17-en-15-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CCC3C4CCC5OC5[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C22H32O3/c1-13(23)24-15-8-10-21(2)14(12-15)4-5-16-17-6-7-19-20(25-19)22(17,3)11-9-18(16)21/h4,15-20H,5-12H2,1-3H3/t15-,16?,17?,18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | RHWOKPUHHZDIDV-QBQDPJSNSA-N |
| XLogP | 4.65 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|