About (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine
(3-methyl-1,3-benzothiazol-2-ylidene)hydrazine (PubChem CID 14319) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine.
Molecular Properties
| Compound Name | (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine |
| PubChem CID | 14319 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine |
| SMILES | Cn1c(=NN)sc2ccccc21 |
| InChI | InChI=1S/C8H9N3S/c1-11-6-4-2-3-5-7(6)12-8(11)10-9/h2-5H,9H2,1H3 |
| InChIKey | PHOLIFLKGONSGY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine?
The IUPAC name of (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine (CID 14319) is (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine.
What is the SMILES notation for (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine?
The canonical SMILES for (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine is Cn1c(=NN)sc2ccccc21.
What is the InChIKey of (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine?
The InChIKey is PHOLIFLKGONSGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-11-6-4-2-3-5-7(6)12-8(11)10-9/h2-5H,9H2,1H3.
What are the key properties of (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine?
(3-methyl-1,3-benzothiazol-2-ylidene)hydrazine has a molecular weight of 179.25 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine is sourced from PubChem (CID 14319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).