About 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol
1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol (PubChem CID 143190664) has the molecular formula C28H32O2
and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol.
Molecular Properties
| Compound Name | 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol |
| PubChem CID | 143190664 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol |
| SMILES | C=C(O)c1ccc(-c2cc(C)c(OCCC)c(C)c2)cc1Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C28H32O2/c1-6-14-30-28-19(3)15-25(16-20(28)4)24-12-13-27(21(5)29)26(18-24)17-23-10-8-22(7-2)9-11-23/h8-13,15-16,18,29H,5-7,14,17H2,1-4H3 |
| InChIKey | JCBCHXVHFZLYJG-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol?
The IUPAC name of 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol (CID 143190664) is 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol.
What is the SMILES notation for 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol?
The canonical SMILES for 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol is C=C(O)c1ccc(-c2cc(C)c(OCCC)c(C)c2)cc1Cc1ccc(CC)cc1.
What is the InChIKey of 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol?
The InChIKey is JCBCHXVHFZLYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32O2/c1-6-14-30-28-19(3)15-25(16-20(28)4)24-12-13-27(21(5)29)26(18-24)17-23-10-8-22(7-2)9-11-23/h8-13,15-16,18,29H,5-7,14,17H2,1-4H3.
What are the key properties of 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol?
1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol has a molecular weight of 400.56 g/mol, XLogP of 7.44, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,5-dimethyl-4-propoxyphenyl)-2-[(4-ethylphenyl)methyl]phenyl]ethenol is sourced from PubChem (CID 143190664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).