C17H27N — CID 143190937
(3E,5Z,8E,10Z)-8-propylidenetetradeca-1,3,5,10-tetraen-4-amine (PubChem CID 143190937) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is (3E,5Z,8E,10Z)-8-propylidenetetradeca-1,3,5,10-tetraen-4-amine.
| Compound Name | (3E,5Z,8E,10Z)-8-propylidenetetradeca-1,3,5,10-tetraen-4-amine |
|---|---|
| PubChem CID | 143190937 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | (3E,5Z,8E,10Z)-8-propylidenetetradeca-1,3,5,10-tetraen-4-amine |
| SMILES | C=C/C=C(N)\C=C/C/C(=C/CC)C/C=C\CCC |
| InChI | InChI=1S/C17H27N/c1-4-7-8-9-13-16(11-5-2)14-10-15-17(18)12-6-3/h6,8-12,15H,3-5,7,13-14,18H2,1-2H3/b9-8-,15-10-,16-11+,17-12+ |
| InChIKey | WPKGPEASRXIDJD-AYMBWSNESA-N |
| XLogP | 5.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|