About 2-azaspiro[5.5]undecane;molecular hydrogen
2-azaspiro[5.5]undecane;molecular hydrogen (PubChem CID 143191023) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 2-azaspiro[5.5]undecane;molecular hydrogen.
Molecular Properties
| Compound Name | 2-azaspiro[5.5]undecane;molecular hydrogen |
| PubChem CID | 143191023 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 2-azaspiro[5.5]undecane;molecular hydrogen |
| SMILES | C1CCC2(CC1)CCCNC2.[H][H] |
| InChI | InChI=1S/C10H19N.H2/c1-2-5-10(6-3-1)7-4-8-11-9-10;/h11H,1-9H2;1H |
| InChIKey | FSUQSGXEJALLHP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-azaspiro[5.5]undecane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[5.5]undecane;molecular hydrogen?
The IUPAC name of 2-azaspiro[5.5]undecane;molecular hydrogen (CID 143191023) is 2-azaspiro[5.5]undecane;molecular hydrogen.
What is the SMILES notation for 2-azaspiro[5.5]undecane;molecular hydrogen?
The canonical SMILES for 2-azaspiro[5.5]undecane;molecular hydrogen is C1CCC2(CC1)CCCNC2.[H][H].
What is the InChIKey of 2-azaspiro[5.5]undecane;molecular hydrogen?
The InChIKey is FSUQSGXEJALLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.H2/c1-2-5-10(6-3-1)7-4-8-11-9-10;/h11H,1-9H2;1H.
What are the key properties of 2-azaspiro[5.5]undecane;molecular hydrogen?
2-azaspiro[5.5]undecane;molecular hydrogen has a molecular weight of 155.28 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[5.5]undecane;molecular hydrogen is sourced from PubChem (CID 143191023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).