2-azaspiro[5.5]undecane;molecular hydrogen

C10H21N — CID 143191023

IUPAC2-azaspiro[5.5]undecane;molecular hydrogen
SMILESC1CCC2(CC1)CCCNC2.[H][H]
InChIInChI=1S/C10H19N.H2/c1-2-5-10(6-3-1)7-4-8-11-9-10;/h11H,1-9H2;1H
InChIKeyFSUQSGXEJALLHP-UHFFFAOYSA-N
MW155.28 g/mol
LogP2.57
Rot. Bonds

About 2-azaspiro[5.5]undecane;molecular hydrogen

2-azaspiro[5.5]undecane;molecular hydrogen (PubChem CID 143191023) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 2-azaspiro[5.5]undecane;molecular hydrogen.

Molecular Properties

Compound Name2-azaspiro[5.5]undecane;molecular hydrogen
PubChem CID143191023
Molecular FormulaC10H21N
Molecular Weight155.28 g/mol
Exact Mass155.17
IUPAC Name2-azaspiro[5.5]undecane;molecular hydrogen
SMILESC1CCC2(CC1)CCCNC2.[H][H]
InChIInChI=1S/C10H19N.H2/c1-2-5-10(6-3-1)7-4-8-11-9-10;/h11H,1-9H2;1H
InChIKeyFSUQSGXEJALLHP-UHFFFAOYSA-N
XLogP2.57
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.28
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-azaspiro[5.5]undecane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-azaspiro[5.5]undecane;molecular hydrogen?
The IUPAC name of 2-azaspiro[5.5]undecane;molecular hydrogen (CID 143191023) is 2-azaspiro[5.5]undecane;molecular hydrogen.
What is the SMILES notation for 2-azaspiro[5.5]undecane;molecular hydrogen?
The canonical SMILES for 2-azaspiro[5.5]undecane;molecular hydrogen is C1CCC2(CC1)CCCNC2.[H][H].
What is the InChIKey of 2-azaspiro[5.5]undecane;molecular hydrogen?
The InChIKey is FSUQSGXEJALLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.H2/c1-2-5-10(6-3-1)7-4-8-11-9-10;/h11H,1-9H2;1H.
What are the key properties of 2-azaspiro[5.5]undecane;molecular hydrogen?
2-azaspiro[5.5]undecane;molecular hydrogen has a molecular weight of 155.28 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[5.5]undecane;molecular hydrogen is sourced from PubChem (CID 143191023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).