C29H26F3N5O3 — CID 143191240
(5R)-5-[3-[[3-[C-(2,4-dimethylphenyl)-N-methylcarbonimidoyl]-2-oxo-6-(trifluoromethyl)benzimidazol-1-yl]methyl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 143191240) has the molecular formula C29H26F3N5O3 and a molecular weight of 549.55 g/mol. Its IUPAC name is (5R)-5-[3-[[3-[C-(2,4-dimethylphenyl)-N-methylcarbonimidoyl]-2-oxo-6-(trifluoromethyl)benzimidazol-1-yl]methyl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[3-[[3-[C-(2,4-dimethylphenyl)-N-methylcarbonimidoyl]-2-oxo-6-(trifluoromethyl)benzimidazol-1-yl]methyl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143191240 |
| Molecular Formula | C29H26F3N5O3 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (5R)-5-[3-[[3-[C-(2,4-dimethylphenyl)-N-methylcarbonimidoyl]-2-oxo-6-(trifluoromethyl)benzimidazol-1-yl]methyl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C/N=C(\c1ccc(C)cc1C)n1c(=O)n(Cc2cccc([C@@]3(C)NC(=O)NC3=O)c2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C29H26F3N5O3/c1-16-8-10-21(17(2)12-16)24(33-4)37-22-11-9-20(29(30,31)32)14-23(22)36(27(37)40)15-18-6-5-7-19(13-18)28(3)25(38)34-26(39)35-28/h5-14H,15H2,1-4H3,(H2,34,35,38,39)/b33-24+/t28-/m1/s1 |
| InChIKey | REMDUZWIYDJLFY-HMKXHNQZSA-N |
| XLogP | 4.47 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|