C15H22O2S — CID 143191730
5,5-dimethyl-3-(4-methylphenyl)sulfanyloxolan-2-one;ethane (PubChem CID 143191730) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 5,5-dimethyl-3-(4-methylphenyl)sulfanyloxolan-2-one;ethane.
| Compound Name | 5,5-dimethyl-3-(4-methylphenyl)sulfanyloxolan-2-one;ethane |
|---|---|
| PubChem CID | 143191730 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 5,5-dimethyl-3-(4-methylphenyl)sulfanyloxolan-2-one;ethane |
| SMILES | CC.Cc1ccc(SC2CC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C13H16O2S.C2H6/c1-9-4-6-10(7-5-9)16-11-8-13(2,3)15-12(11)14;1-2/h4-7,11H,8H2,1-3H3;1-2H3 |
| InChIKey | BXKPZDUDSWOVDJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |