About 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane
1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane (PubChem CID 143191990) has the molecular formula C14H16Cl2N2
and a molecular weight of 283.20 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane |
| PubChem CID | 143191990 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane |
| SMILES | C=c1cnn(Cc2ccc(Cl)cc2Cl)c1=C.CC |
| InChI | InChI=1S/C12H10Cl2N2.C2H6/c1-8-6-15-16(9(8)2)7-10-3-4-11(13)5-12(10)14;1-2/h3-6H,1-2,7H2;1-2H3 |
| InChIKey | LSYZEPBAHQNBSS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane?
The IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane (CID 143191990) is 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane?
The canonical SMILES for 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane is C=c1cnn(Cc2ccc(Cl)cc2Cl)c1=C.CC.
What is the InChIKey of 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane?
The InChIKey is LSYZEPBAHQNBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2.C2H6/c1-8-6-15-16(9(8)2)7-10-3-4-11(13)5-12(10)14;1-2/h3-6H,1-2,7H2;1-2H3.
What are the key properties of 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane?
1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane has a molecular weight of 283.20 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)methyl]-4,5-dimethylidenepyrazole;ethane is sourced from PubChem (CID 143191990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).