About 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine
4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine (PubChem CID 143192099) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine |
| PubChem CID | 143192099 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine |
| SMILES | C1=C(C[C@@H]2CCCN2)NCC=C1N1CCCC1 |
| InChI | InChI=1S/C14H23N3/c1-2-9-17(8-1)14-5-7-16-13(11-14)10-12-4-3-6-15-12/h5,11-12,15-16H,1-4,6-10H2/t12-/m0/s1 |
| InChIKey | AGPHFUVAJHXDDF-LBPRGKRZSA-N |
| XLogP | 1.60 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine?
The IUPAC name of 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine (CID 143192099) is 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine.
What is the SMILES notation for 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine?
The canonical SMILES for 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine is C1=C(C[C@@H]2CCCN2)NCC=C1N1CCCC1.
What is the InChIKey of 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine?
The InChIKey is AGPHFUVAJHXDDF-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H23N3/c1-2-9-17(8-1)14-5-7-16-13(11-14)10-12-4-3-6-15-12/h5,11-12,15-16H,1-4,6-10H2/t12-/m0/s1.
What are the key properties of 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine?
4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine has a molecular weight of 233.36 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolidin-1-yl-6-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-dihydropyridine is sourced from PubChem (CID 143192099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).