About ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine
ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine (PubChem CID 143192100) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine.
Molecular Properties
| Compound Name | ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine |
| PubChem CID | 143192100 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine |
| SMILES | C1CNC(CN2CCCC2)C1.CC.CCC |
| InChI | InChI=1S/C9H18N2.C3H8.C2H6/c1-2-7-11(6-1)8-9-4-3-5-10-9;1-3-2;1-2/h9-10H,1-8H2;3H2,1-2H3;1-2H3 |
| InChIKey | YMIJHKACTYCGKS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine?
The IUPAC name of ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine (CID 143192100) is ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine.
What is the SMILES notation for ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine?
The canonical SMILES for ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine is C1CNC(CN2CCCC2)C1.CC.CCC.
What is the InChIKey of ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine?
The InChIKey is YMIJHKACTYCGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.C3H8.C2H6/c1-2-7-11(6-1)8-9-4-3-5-10-9;1-3-2;1-2/h9-10H,1-8H2;3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine?
ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine has a molecular weight of 228.42 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;1-(pyrrolidin-2-ylmethyl)pyrrolidine is sourced from PubChem (CID 143192100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).