C21H20N5O3S- — CID 143192534
2-[11-[2-[4-(oxidoamino)phenyl]ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethanol (PubChem CID 143192534) has the molecular formula C21H20N5O3S- and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[11-[2-[4-(oxidoamino)phenyl]ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethanol.
| Compound Name | 2-[11-[2-[4-(oxidoamino)phenyl]ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethanol |
|---|---|
| PubChem CID | 143192534 |
| Molecular Formula | C21H20N5O3S- |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-[11-[2-[4-(oxidoamino)phenyl]ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethanol |
| SMILES | [O-]Nc1ccc(CCOc2ncnc3sc4c(c23)CCc2c-4cnn2CCO)cc1 |
| InChI | InChI=1S/C21H20N5O3S/c27-9-8-26-17-6-5-15-18-20(29-10-7-13-1-3-14(25-28)4-2-13)22-12-23-21(18)30-19(15)16(17)11-24-26/h1-4,11-12,25,27H,5-10H2/q-1 |
| InChIKey | QMWCYZSMLBWCIX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|