C21H18IN5O3S — CID 143192574
4-(2-iodoethyl)-11-[2-(4-nitrophenyl)ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaene (PubChem CID 143192574) has the molecular formula C21H18IN5O3S and a molecular weight of 547.38 g/mol. Its IUPAC name is 4-(2-iodoethyl)-11-[2-(4-nitrophenyl)ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaene.
| Compound Name | 4-(2-iodoethyl)-11-[2-(4-nitrophenyl)ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaene |
|---|---|
| PubChem CID | 143192574 |
| Molecular Formula | C21H18IN5O3S |
| Molecular Weight | 547.38 g/mol |
| Exact Mass | 547.02 |
| IUPAC Name | 4-(2-iodoethyl)-11-[2-(4-nitrophenyl)ethoxy]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,5,10,12,14-hexaene |
| SMILES | O=[N+]([O-])c1ccc(CCOc2ncnc3sc4c(c23)CCc2nn(CCI)cc2-4)cc1 |
| InChI | InChI=1S/C21H18IN5O3S/c22-8-9-26-11-16-17(25-26)6-5-15-18-20(23-12-24-21(18)31-19(15)16)30-10-7-13-1-3-14(4-2-13)27(28)29/h1-4,11-12H,5-10H2 |
| InChIKey | LFSZHIOCORWEDV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|