About 4-pyridin-4-ylpyridine;bis(trifluoroborane)
4-pyridin-4-ylpyridine;bis(trifluoroborane) (PubChem CID 14319291) has the molecular formula C10H8B2F6N2
and a molecular weight of 291.80 g/mol. Its IUPAC name is 4-pyridin-4-ylpyridine;bis(trifluoroborane).
Molecular Properties
| Compound Name | 4-pyridin-4-ylpyridine;bis(trifluoroborane) |
| PubChem CID | 14319291 |
| Molecular Formula | C10H8B2F6N2 |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-pyridin-4-ylpyridine;bis(trifluoroborane) |
| SMILES | FB(F)F.FB(F)F.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2BF3/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*2-1(3)4/h1-8H;; |
| InChIKey | OTZZNSPROXEHDE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-4-ylpyridine;bis(trifluoroborane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-ylpyridine;bis(trifluoroborane)?
The IUPAC name of 4-pyridin-4-ylpyridine;bis(trifluoroborane) (CID 14319291) is 4-pyridin-4-ylpyridine;bis(trifluoroborane).
What is the SMILES notation for 4-pyridin-4-ylpyridine;bis(trifluoroborane)?
The canonical SMILES for 4-pyridin-4-ylpyridine;bis(trifluoroborane) is FB(F)F.FB(F)F.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of 4-pyridin-4-ylpyridine;bis(trifluoroborane)?
The InChIKey is OTZZNSPROXEHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2BF3/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*2-1(3)4/h1-8H;;.
What are the key properties of 4-pyridin-4-ylpyridine;bis(trifluoroborane)?
4-pyridin-4-ylpyridine;bis(trifluoroborane) has a molecular weight of 291.80 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-ylpyridine;bis(trifluoroborane) is sourced from PubChem (CID 14319291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).