C19H27N9 — CID 143193135
6-N-(2-aminoethyl)-4-N-(3-aminophenyl)-2-N-cyclohepta-1,3,6-trien-1-yl-1,3,5-triazine-2,4,6-triamine;methanamine (PubChem CID 143193135) has the molecular formula C19H27N9 and a molecular weight of 381.49 g/mol. Its IUPAC name is 6-N-(2-aminoethyl)-4-N-(3-aminophenyl)-2-N-cyclohepta-1,3,6-trien-1-yl-1,3,5-triazine-2,4,6-triamine;methanamine.
| Compound Name | 6-N-(2-aminoethyl)-4-N-(3-aminophenyl)-2-N-cyclohepta-1,3,6-trien-1-yl-1,3,5-triazine-2,4,6-triamine;methanamine |
|---|---|
| PubChem CID | 143193135 |
| Molecular Formula | C19H27N9 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 6-N-(2-aminoethyl)-4-N-(3-aminophenyl)-2-N-cyclohepta-1,3,6-trien-1-yl-1,3,5-triazine-2,4,6-triamine;methanamine |
| SMILES | CN.NCCNc1nc(NC2=CC=CCC=C2)nc(Nc2cccc(N)c2)n1 |
| InChI | InChI=1S/C18H22N8.CH5N/c19-10-11-21-16-24-17(22-14-7-3-1-2-4-8-14)26-18(25-16)23-15-9-5-6-13(20)12-15;1-2/h1,3-9,12H,2,10-11,19-20H2,(H3,21,22,23,24,25,26);2H2,1H3 |
| InChIKey | XUMGCQNXZDLXAE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|