C19H22N8 — CID 143193149
4-N-(3-aminophenyl)-6-N-cyclopropyl-2-N-[3-(methylamino)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 143193149) has the molecular formula C19H22N8 and a molecular weight of 362.44 g/mol. Its IUPAC name is 4-N-(3-aminophenyl)-6-N-cyclopropyl-2-N-[3-(methylamino)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(3-aminophenyl)-6-N-cyclopropyl-2-N-[3-(methylamino)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 143193149 |
| Molecular Formula | C19H22N8 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 4-N-(3-aminophenyl)-6-N-cyclopropyl-2-N-[3-(methylamino)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1cccc(Nc2nc(Nc3cccc(N)c3)nc(NC3CC3)n2)c1 |
| InChI | InChI=1S/C19H22N8/c1-21-14-5-3-7-16(11-14)24-19-26-17(22-13-8-9-13)25-18(27-19)23-15-6-2-4-12(20)10-15/h2-7,10-11,13,21H,8-9,20H2,1H3,(H3,22,23,24,25,26,27) |
| InChIKey | FGRWGLBSIFKEKY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|