C17H34 — CID 143193150
ethene;2-methylprop-1-ene;3,3,6,6-tetramethylhept-1-ene (PubChem CID 143193150) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is ethene;2-methylprop-1-ene;3,3,6,6-tetramethylhept-1-ene.
| Compound Name | ethene;2-methylprop-1-ene;3,3,6,6-tetramethylhept-1-ene |
|---|---|
| PubChem CID | 143193150 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | ethene;2-methylprop-1-ene;3,3,6,6-tetramethylhept-1-ene |
| SMILES | C=C.C=C(C)C.C=CC(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C11H22.C4H8.C2H4/c1-7-11(5,6)9-8-10(2,3)4;1-4(2)3;1-2/h7H,1,8-9H2,2-6H3;1H2,2-3H3;1-2H2 |
| InChIKey | BNTMVHKLYKSYRG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|