About 4-methanimidoylcyclohexa-2,4-dien-1-ol
4-methanimidoylcyclohexa-2,4-dien-1-ol (PubChem CID 143193805) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 4-methanimidoylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-methanimidoylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 143193805 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 4-methanimidoylcyclohexa-2,4-dien-1-ol |
| SMILES | [H]/N=C/C1=CCC(O)C=C1 |
| InChI | InChI=1S/C7H9NO/c8-5-6-1-3-7(9)4-2-6/h1-3,5,7-9H,4H2/b8-5+ |
| InChIKey | JAQYQSBQVUEWBF-VMPITWQZSA-N |
| XLogP | 0.88 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methanimidoylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methanimidoylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-methanimidoylcyclohexa-2,4-dien-1-ol (CID 143193805) is 4-methanimidoylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-methanimidoylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-methanimidoylcyclohexa-2,4-dien-1-ol is [H]/N=C/C1=CCC(O)C=C1.
What is the InChIKey of 4-methanimidoylcyclohexa-2,4-dien-1-ol?
The InChIKey is JAQYQSBQVUEWBF-VMPITWQZSA-N. The full InChI is InChI=1S/C7H9NO/c8-5-6-1-3-7(9)4-2-6/h1-3,5,7-9H,4H2/b8-5+.
What are the key properties of 4-methanimidoylcyclohexa-2,4-dien-1-ol?
4-methanimidoylcyclohexa-2,4-dien-1-ol has a molecular weight of 123.15 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methanimidoylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 143193805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).