C12H17N3O2 — CID 143193983
[(1S,2S,4R)-2,4-diaminocyclopentyl] 2-aminobenzoate (PubChem CID 143193983) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is [(1S,2S,4R)-2,4-diaminocyclopentyl] 2-aminobenzoate.
| Compound Name | [(1S,2S,4R)-2,4-diaminocyclopentyl] 2-aminobenzoate |
|---|---|
| PubChem CID | 143193983 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | [(1S,2S,4R)-2,4-diaminocyclopentyl] 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)O[C@H]1C[C@H](N)C[C@@H]1N |
| InChI | InChI=1S/C12H17N3O2/c13-7-5-10(15)11(6-7)17-12(16)8-3-1-2-4-9(8)14/h1-4,7,10-11H,5-6,13-15H2/t7-,10+,11+/m1/s1 |
| InChIKey | WVPMOJQIUOQNHQ-GGVZMXCHSA-N |
| XLogP | 0.24 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|