C11H20N4O — CID 143194050
cis-(1S,3R)-cyclopentane-1,3-diamine;2,4-diaminophenol (PubChem CID 143194050) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is cis-(1S,3R)-cyclopentane-1,3-diamine;2,4-diaminophenol.
| Compound Name | cis-(1S,3R)-cyclopentane-1,3-diamine;2,4-diaminophenol |
|---|---|
| PubChem CID | 143194050 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | cis-(1S,3R)-cyclopentane-1,3-diamine;2,4-diaminophenol |
| SMILES | N[C@@H]1CC[C@H](N)C1.Nc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C6H8N2O.C5H12N2/c7-4-1-2-6(9)5(8)3-4;6-4-1-2-5(7)3-4/h1-3,9H,7-8H2;4-5H,1-3,6-7H2/t;4-,5+ |
| InChIKey | ITGLHMQJPROOHS-OVVSMXPMSA-N |
| XLogP | 0.38 |
| TPSA | 124.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|